C27H43NO5Si — CID 134906719
diethyl 2-[2-[5-methoxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]propanedioate (PubChem CID 134906719) has the molecular formula C27H43NO5Si and a molecular weight of 489.73 g/mol. Its IUPAC name is diethyl 2-[2-[5-methoxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]propanedioate.
| Compound Name | diethyl 2-[2-[5-methoxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 134906719 |
| Molecular Formula | C27H43NO5Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | diethyl 2-[2-[5-methoxy-1-tri(propan-2-yl)silylindol-3-yl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1cn([Si](C(C)C)(C(C)C)C(C)C)c2ccc(OC)cc12)C(=O)OCC |
| InChI | InChI=1S/C27H43NO5Si/c1-10-32-26(29)23(27(30)33-11-2)14-12-21-17-28(25-15-13-22(31-9)16-24(21)25)34(18(3)4,19(5)6)20(7)8/h13,15-20,23H,10-12,14H2,1-9H3 |
| InChIKey | HUXAALBJCBYULU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|