C32H30N4O2 — CID 10029033
ethyl 1-(6-cyclohexyl-2-phenylquinolin-4-yl)-5-phenyltriazole-4-carboxylate (PubChem CID 10029033) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is ethyl 1-(6-cyclohexyl-2-phenylquinolin-4-yl)-5-phenyltriazole-4-carboxylate.
| Compound Name | ethyl 1-(6-cyclohexyl-2-phenylquinolin-4-yl)-5-phenyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 10029033 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | ethyl 1-(6-cyclohexyl-2-phenylquinolin-4-yl)-5-phenyltriazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(-c2cc(-c3ccccc3)nc3ccc(C4CCCCC4)cc23)c1-c1ccccc1 |
| InChI | InChI=1S/C32H30N4O2/c1-2-38-32(37)30-31(24-16-10-5-11-17-24)36(35-34-30)29-21-28(23-14-8-4-9-15-23)33-27-19-18-25(20-26(27)29)22-12-6-3-7-13-22/h4-5,8-11,14-22H,2-3,6-7,12-13H2,1H3 |
| InChIKey | ZALDLBFSDORCCR-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |