C20H39N9O7S — CID 10030440
(2S)-5-amino-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-sulfanylpropanoyl]amino]pentanoic acid (PubChem CID 10030440) has the molecular formula C20H39N9O7S and a molecular weight of 549.66 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-sulfanylpropanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-sulfanylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10030440 |
| Molecular Formula | C20H39N9O7S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-sulfanylpropanoyl]amino]pentanoic acid |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CS)C(=O)N[C@@H](CCCN)C(=O)O |
| InChI | InChI=1S/C20H39N9O7S/c1-10(30)15(22)18(34)28-11(5-3-7-25-20(23)24)16(32)26-8-14(31)27-13(9-37)17(33)29-12(19(35)36)4-2-6-21/h10-13,15,30,37H,2-9,21-22H2,1H3,(H,26,32)(H,27,31)(H,28,34)(H,29,33)(H,35,36)(H4,23,24,25)/t10-,11-,12+,13-,15+/m1/s1 |
| InChIKey | CPFXHBJKKLPJJM-VVSAWPALSA-N |
| XLogP | -4.93 |
| TPSA | 290.37 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|