C31H21N7O5 — CID 10030943
N-(5,6-diphenyl-1,2,4-triazin-3-yl)-3,5-dinitro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide (PubChem CID 10030943) has the molecular formula C31H21N7O5 and a molecular weight of 571.55 g/mol. Its IUPAC name is N-(5,6-diphenyl-1,2,4-triazin-3-yl)-3,5-dinitro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide.
| Compound Name | N-(5,6-diphenyl-1,2,4-triazin-3-yl)-3,5-dinitro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide |
|---|---|
| PubChem CID | 10030943 |
| Molecular Formula | C31H21N7O5 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | N-(5,6-diphenyl-1,2,4-triazin-3-yl)-3,5-dinitro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(/N=C/C=C/c1ccccc1)c1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C31H21N7O5/c39-30(25-19-26(37(40)41)21-27(20-25)38(42)43)36(32-18-10-13-22-11-4-1-5-12-22)31-33-28(23-14-6-2-7-15-23)29(34-35-31)24-16-8-3-9-17-24/h1-21H/b13-10+,32-18+ |
| InChIKey | XPVAHVWOQPGWSR-BMXDAKTDSA-N |
| XLogP | 6.37 |
| TPSA | 157.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|