C16H12N4O3 — CID 6404991
5-methoxy-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine (PubChem CID 6404991) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 5-methoxy-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine.
| Compound Name | 5-methoxy-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 6404991 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-methoxy-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine |
| SMILES | COc1nc(-c2ccc([N+](=O)[O-])cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H12N4O3/c1-23-16-14(11-5-3-2-4-6-11)18-19-15(17-16)12-7-9-13(10-8-12)20(21)22/h2-10H,1H3 |
| InChIKey | PMODYVDPUFZDCG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|