C23H17ClN4O4S — CID 10928931
5-[chloro-(4-methylphenyl)sulfonylmethyl]-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine (PubChem CID 10928931) has the molecular formula C23H17ClN4O4S and a molecular weight of 480.93 g/mol. Its IUPAC name is 5-[chloro-(4-methylphenyl)sulfonylmethyl]-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine.
| Compound Name | 5-[chloro-(4-methylphenyl)sulfonylmethyl]-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine |
|---|---|
| PubChem CID | 10928931 |
| Molecular Formula | C23H17ClN4O4S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 5-[chloro-(4-methylphenyl)sulfonylmethyl]-3-(4-nitrophenyl)-6-phenyl-1,2,4-triazine |
| SMILES | Cc1ccc(S(=O)(=O)C(Cl)c2nc(-c3ccc([N+](=O)[O-])cc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17ClN4O4S/c1-15-7-13-19(14-8-15)33(31,32)22(24)21-20(16-5-3-2-4-6-16)26-27-23(25-21)17-9-11-18(12-10-17)28(29)30/h2-14,22H,1H3 |
| InChIKey | QKDOWTUYIXHPLP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 115.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|