C12F25NO — CID 10032179
(1Z)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)hexanimidoyl fluoride (PubChem CID 10032179) has the molecular formula C12F25NO and a molecular weight of 649.09 g/mol. Its IUPAC name is (1Z)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)hexanimidoyl fluoride.
| Compound Name | (1Z)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)hexanimidoyl fluoride |
|---|---|
| PubChem CID | 10032179 |
| Molecular Formula | C12F25NO |
| Molecular Weight | 649.09 g/mol |
| Exact Mass | 648.96 |
| IUPAC Name | (1Z)-2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)hexanimidoyl fluoride |
| SMILES | F/C(=N\OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F25NO/c13-1(2(14,15)3(16,17)4(18,19)7(24,25)10(30,31)32)38-39-12(36,37)9(28,29)6(22,23)5(20,21)8(26,27)11(33,34)35/b38-1- |
| InChIKey | HMMYUQKVJOEWQL-HLQXBTSDSA-N |
| XLogP | 8.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.09 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|