C8F17NO — CID 10321465
(1Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)butanimidoyl fluoride (PubChem CID 10321465) has the molecular formula C8F17NO and a molecular weight of 449.06 g/mol. Its IUPAC name is (1Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)butanimidoyl fluoride.
| Compound Name | (1Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)butanimidoyl fluoride |
|---|---|
| PubChem CID | 10321465 |
| Molecular Formula | C8F17NO |
| Molecular Weight | 449.06 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | (1Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)butanimidoyl fluoride |
| SMILES | F/C(=N\OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F17NO/c9-1(2(10,11)3(12,13)6(18,19)20)26-27-8(24,25)5(16,17)4(14,15)7(21,22)23/b26-1- |
| InChIKey | VKKBJRRQUVWOGJ-CYPCERQJSA-N |
| XLogP | 5.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|