C15H17N3O2 — CID 10038827
(1R,7S,8R)-4-methyl-8-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 10038827) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (1R,7S,8R)-4-methyl-8-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | (1R,7S,8R)-4-methyl-8-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 10038827 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (1R,7S,8R)-4-methyl-8-phenyl-2,4,6-triazatricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@H]1CC[C@@H]2C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H17N3O2/c1-16-14(19)17-11-7-8-13(18(17)15(16)20)12(9-11)10-5-3-2-4-6-10/h2-6,11-13H,7-9H2,1H3/t11-,12-,13+/m1/s1 |
| InChIKey | NTQABLDADAGOGD-UPJWGTAASA-N |
| XLogP | 1.41 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |