C24H25N3O2 — CID 13166425
10,10,13,16,16-pentamethyl-8-phenyl-11,13,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 13166425) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 10,10,13,16,16-pentamethyl-8-phenyl-11,13,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | 10,10,13,16,16-pentamethyl-8-phenyl-11,13,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 13166425 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 10,10,13,16,16-pentamethyl-8-phenyl-11,13,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C(C)(C)C1C(=C(c3ccccc3)c3ccccc31)C2(C)C |
| InChI | InChI=1S/C24H25N3O2/c1-23(2)19-17-14-10-9-13-16(17)18(15-11-7-6-8-12-15)20(19)24(3,4)27-22(29)25(5)21(28)26(23)27/h6-14,19H,1-5H3 |
| InChIKey | URBPCRXZXMARCY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |