C24H25N3O2 — CID 13166424
2,2,6,6,9-pentamethyl-4,4-diphenyl-1,7,9-triazatricyclo[5.3.0.03,5]dec-3(5)-ene-8,10-dione (PubChem CID 13166424) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2,2,6,6,9-pentamethyl-4,4-diphenyl-1,7,9-triazatricyclo[5.3.0.03,5]dec-3(5)-ene-8,10-dione.
| Compound Name | 2,2,6,6,9-pentamethyl-4,4-diphenyl-1,7,9-triazatricyclo[5.3.0.03,5]dec-3(5)-ene-8,10-dione |
|---|---|
| PubChem CID | 13166424 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2,2,6,6,9-pentamethyl-4,4-diphenyl-1,7,9-triazatricyclo[5.3.0.03,5]dec-3(5)-ene-8,10-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C(C)(C)C1=C(C1(c1ccccc1)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C24H25N3O2/c1-22(2)18-19(23(3,4)27-21(29)25(5)20(28)26(22)27)24(18,16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15H,1-5H3 |
| InChIKey | HIQUHKWXQCZKCZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|