C23H23N3O2 — CID 10833160
(1S,7R,10S,11S)-4,10,11-trimethyl-1,7-diphenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 10833160) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (1S,7R,10S,11S)-4,10,11-trimethyl-1,7-diphenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,7R,10S,11S)-4,10,11-trimethyl-1,7-diphenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 10833160 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (1S,7R,10S,11S)-4,10,11-trimethyl-1,7-diphenyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | C[C@H]1[C@H](C)[C@]2(c3ccccc3)C=C[C@@]1(c1ccccc1)n1c(=O)n(C)c(=O)n12 |
| InChI | InChI=1S/C23H23N3O2/c1-16-17(2)23(19-12-8-5-9-13-19)15-14-22(16,18-10-6-4-7-11-18)25-20(27)24(3)21(28)26(23)25/h4-17H,1-3H3/t16-,17-,22-,23+/m0/s1 |
| InChIKey | FYACFCKZHCOHET-BSWISCRUSA-N |
| XLogP | 2.69 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|