C24H25N5O2 — CID 13166423
2,2,8,8,11-pentamethyl-6,6-diphenyl-1,4,5,9,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-10,12-dione (PubChem CID 13166423) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2,2,8,8,11-pentamethyl-6,6-diphenyl-1,4,5,9,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-10,12-dione.
| Compound Name | 2,2,8,8,11-pentamethyl-6,6-diphenyl-1,4,5,9,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-10,12-dione |
|---|---|
| PubChem CID | 13166423 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2,2,8,8,11-pentamethyl-6,6-diphenyl-1,4,5,9,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-10,12-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C(C)(C)C1=C(N=NC1(c1ccccc1)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C24H25N5O2/c1-22(2)18-19(23(3,4)29-21(31)27(5)20(30)28(22)29)25-26-24(18,16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15H,1-5H3 |
| InChIKey | URHFZEHGFPACHJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |