C22H23N3O2 — CID 10248044
(2R,4S)-2,4-dibenzyl-3,3,7-trimethyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione (PubChem CID 10248044) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2R,4S)-2,4-dibenzyl-3,3,7-trimethyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione.
| Compound Name | (2R,4S)-2,4-dibenzyl-3,3,7-trimethyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione |
|---|---|
| PubChem CID | 10248044 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2R,4S)-2,4-dibenzyl-3,3,7-trimethyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@]1(Cc3ccccc3)C(C)(C)[C@]21Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c1-20(2)21(14-16-10-6-4-7-11-16)22(20,15-17-12-8-5-9-13-17)25-19(27)23(3)18(26)24(21)25/h4-13H,14-15H2,1-3H3/t21-,22+ |
| InChIKey | INYDPBXQXDMYQE-SZPZYZBQSA-N |
| XLogP | 2.28 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |