C15H17N3O2 — CID 10858587
(2S,4S)-2,3,3,7-tetramethyl-4-phenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione (PubChem CID 10858587) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S,4S)-2,3,3,7-tetramethyl-4-phenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione.
| Compound Name | (2S,4S)-2,3,3,7-tetramethyl-4-phenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione |
|---|---|
| PubChem CID | 10858587 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2S,4S)-2,3,3,7-tetramethyl-4-phenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@]1(c3ccccc3)C(C)(C)[C@]21C |
| InChI | InChI=1S/C15H17N3O2/c1-13(2)14(3)15(13,10-8-6-5-7-9-10)18-12(20)16(4)11(19)17(14)18/h5-9H,1-4H3/t14-,15-/m0/s1 |
| InChIKey | GPCFJHTYYKVEBN-GJZGRUSLSA-N |
| XLogP | 0.86 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |