C20H19N3O2 — CID 15204383
(2R,4S)-3,3,7-trimethyl-2,4-diphenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione (PubChem CID 15204383) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (2R,4S)-3,3,7-trimethyl-2,4-diphenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione.
| Compound Name | (2R,4S)-3,3,7-trimethyl-2,4-diphenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione |
|---|---|
| PubChem CID | 15204383 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2R,4S)-3,3,7-trimethyl-2,4-diphenyl-1,5,7-triazatricyclo[3.3.0.02,4]octane-6,8-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@]1(c3ccccc3)C(C)(C)[C@]21c1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c1-18(2)19(14-10-6-4-7-11-14)20(18,15-12-8-5-9-13-15)23-17(25)21(3)16(24)22(19)23/h4-13H,1-3H3/t19-,20+ |
| InChIKey | JNVXGDWIMDIYAQ-BGYRXZFFSA-N |
| XLogP | 1.89 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |