C25H23N3O2 — CID 94037448
(1S,7R,8S,11R)-4,8,11-trimethyl-9,10-diphenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 94037448) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (1S,7R,8S,11R)-4,8,11-trimethyl-9,10-diphenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1S,7R,8S,11R)-4,8,11-trimethyl-9,10-diphenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 94037448 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (1S,7R,8S,11R)-4,8,11-trimethyl-9,10-diphenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1C=C[C@H]2[C@]2(C)C(c3ccccc3)=C(c3ccccc3)[C@]12C |
| InChI | InChI=1S/C25H23N3O2/c1-24-18-14-15-19(28-23(30)26(3)22(29)27(18)28)25(24,2)21(17-12-8-5-9-13-17)20(24)16-10-6-4-7-11-16/h4-15,18-19H,1-3H3/t18-,19+,24+,25- |
| InChIKey | QYOCYYHBFNXHQC-TXHUAPDYSA-N |
| XLogP | 3.65 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|