C25H27N3O2 — CID 10811053
(1S,7R,10S,11R)-4,10,11-trimethyl-1,7-bis(4-methylphenyl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 10811053) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (1S,7R,10S,11R)-4,10,11-trimethyl-1,7-bis(4-methylphenyl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,7R,10S,11R)-4,10,11-trimethyl-1,7-bis(4-methylphenyl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 10811053 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (1S,7R,10S,11R)-4,10,11-trimethyl-1,7-bis(4-methylphenyl)-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | Cc1ccc([C@@]23C=C[C@@](c4ccc(C)cc4)([C@@H](C)[C@H]2C)n2c(=O)n(C)c(=O)n23)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-16-6-10-20(11-7-16)24-14-15-25(19(4)18(24)3,21-12-8-17(2)9-13-21)28-23(30)26(5)22(29)27(24)28/h6-15,18-19H,1-5H3/t18-,19+,24-,25+ |
| InChIKey | CAVOVEIWHWBSQG-VHQMJQKASA-N |
| XLogP | 3.31 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|