C22H21N3O3 — CID 18722093
5-acetyl-2-(2,2-diphenylethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 18722093) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 5-acetyl-2-(2,2-diphenylethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | 5-acetyl-2-(2,2-diphenylethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 18722093 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-acetyl-2-(2,2-diphenylethyl)-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | CC(=O)C1C=CCn2c(=O)n(CC(c3ccccc3)c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C22H21N3O3/c1-16(26)20-13-8-14-24-21(27)23(22(28)25(20)24)15-19(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-13,19-20H,14-15H2,1H3 |
| InChIKey | UXCMYQMHUMIEDW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|