C13H24O4Si — CID 10038918
(3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 10038918) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is (3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10038918 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (3R,3aR,5R,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(=O)O[C@H]2C[C@H](O)C[C@H]21 |
| InChI | InChI=1S/C13H24O4Si/c1-13(2,3)18(4,5)17-11-9-6-8(14)7-10(9)16-12(11)15/h8-11,14H,6-7H2,1-5H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | ZVMIYXGXTKLSBZ-CHWFTXMASA-N |
| XLogP | 2.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|