C17H24O3 — CID 10039127
ethyl (4aS,5S,7aR)-4a-methyl-1,2,3,5,7a,8,9,10-octahydroazuleno[5,4-b]pyran-5-carboxylate (PubChem CID 10039127) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl (4aS,5S,7aR)-4a-methyl-1,2,3,5,7a,8,9,10-octahydroazuleno[5,4-b]pyran-5-carboxylate.
| Compound Name | ethyl (4aS,5S,7aR)-4a-methyl-1,2,3,5,7a,8,9,10-octahydroazuleno[5,4-b]pyran-5-carboxylate |
|---|---|
| PubChem CID | 10039127 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethyl (4aS,5S,7aR)-4a-methyl-1,2,3,5,7a,8,9,10-octahydroazuleno[5,4-b]pyran-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=C[C@H]2CCCC2=C2CCCO[C@]21C |
| InChI | InChI=1S/C17H24O3/c1-3-19-16(18)15-10-9-12-6-4-7-13(12)14-8-5-11-20-17(14,15)2/h9-10,12,15H,3-8,11H2,1-2H3/t12-,15-,17-/m1/s1 |
| InChIKey | WWSPRZYBTHHBQJ-SRCQZFHVSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|