About [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone
[1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 1003984) has the molecular formula C16H20Cl2N2O3S
and a molecular weight of 391.32 g/mol. Its IUPAC name is [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 1003984 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)N1CCCC1 |
| InChI | InChI=1S/C16H20Cl2N2O3S/c17-13-3-4-14(18)15(11-13)24(22,23)20-9-5-12(6-10-20)16(21)19-7-1-2-8-19/h3-4,11-12H,1-2,5-10H2 |
| InChIKey | BZKXKANMTZBKDQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone (CID 1003984) is [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone is O=C(C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)N1CCCC1.
What is the InChIKey of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is BZKXKANMTZBKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O3S/c17-13-3-4-14(18)15(11-13)24(22,23)20-9-5-12(6-10-20)16(21)19-7-1-2-8-19/h3-4,11-12H,1-2,5-10H2.
What are the key properties of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone?
[1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 391.32 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 1003984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).