C15H15F3N2O — CID 10040200
1-(1-tert-butyl-3-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone (PubChem CID 10040200) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-(1-tert-butyl-3-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-tert-butyl-3-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 10040200 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-(1-tert-butyl-3-phenylpyrazol-4-yl)-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)n1cc(C(=O)C(F)(F)F)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H15F3N2O/c1-14(2,3)20-9-11(13(21)15(16,17)18)12(19-20)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | SODGGVNMVQKLIE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |