C14H14F2N2O2 — CID 43324405
1-tert-butyl-3-(2,6-difluorophenyl)pyrazole-4-carboxylic acid (PubChem CID 43324405) has the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,6-difluorophenyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-tert-butyl-3-(2,6-difluorophenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43324405 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-tert-butyl-3-(2,6-difluorophenyl)pyrazole-4-carboxylic acid |
| SMILES | CC(C)(C)n1cc(C(=O)O)c(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C14H14F2N2O2/c1-14(2,3)18-7-8(13(19)20)12(17-18)11-9(15)5-4-6-10(11)16/h4-7H,1-3H3,(H,19,20) |
| InChIKey | METWLLAMVPGOAT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |