C14H13ClF2N2O — CID 142566404
2-[3-(2,6-difluorophenyl)-4-methylpyrazol-1-yl]-2-methylpropanoyl chloride (PubChem CID 142566404) has the molecular formula C14H13ClF2N2O and a molecular weight of 298.72 g/mol. Its IUPAC name is 2-[3-(2,6-difluorophenyl)-4-methylpyrazol-1-yl]-2-methylpropanoyl chloride.
| Compound Name | 2-[3-(2,6-difluorophenyl)-4-methylpyrazol-1-yl]-2-methylpropanoyl chloride |
|---|---|
| PubChem CID | 142566404 |
| Molecular Formula | C14H13ClF2N2O |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[3-(2,6-difluorophenyl)-4-methylpyrazol-1-yl]-2-methylpropanoyl chloride |
| SMILES | Cc1cn(C(C)(C)C(=O)Cl)nc1-c1c(F)cccc1F |
| InChI | InChI=1S/C14H13ClF2N2O/c1-8-7-19(14(2,3)13(15)20)18-12(8)11-9(16)5-4-6-10(11)17/h4-7H,1-3H3 |
| InChIKey | IMKWWNLUGWHIPO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|