C20H20N2S — CID 10041702
(2E,4E)-2-(N-methylanilino)-6-phenylsulfanylhepta-2,4-dienenitrile (PubChem CID 10041702) has the molecular formula C20H20N2S and a molecular weight of 320.46 g/mol. Its IUPAC name is (2E,4E)-2-(N-methylanilino)-6-phenylsulfanylhepta-2,4-dienenitrile.
| Compound Name | (2E,4E)-2-(N-methylanilino)-6-phenylsulfanylhepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 10041702 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2E,4E)-2-(N-methylanilino)-6-phenylsulfanylhepta-2,4-dienenitrile |
| SMILES | CC(/C=C/C=C(\C#N)N(C)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C20H20N2S/c1-17(23-20-14-7-4-8-15-20)10-9-13-19(16-21)22(2)18-11-5-3-6-12-18/h3-15,17H,1-2H3/b10-9+,19-13+ |
| InChIKey | ZTUMNPVMIHUSLE-OHNABYMDSA-N |
| XLogP | 5.27 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|