C23H25IN2O — CID 10050481
(Z)-7-iodo-2-(N-methylanilino)-4-[(E)-2-phenylmethoxyethenyl]hept-2-enenitrile (PubChem CID 10050481) has the molecular formula C23H25IN2O and a molecular weight of 472.37 g/mol. Its IUPAC name is (Z)-7-iodo-2-(N-methylanilino)-4-[(E)-2-phenylmethoxyethenyl]hept-2-enenitrile.
| Compound Name | (Z)-7-iodo-2-(N-methylanilino)-4-[(E)-2-phenylmethoxyethenyl]hept-2-enenitrile |
|---|---|
| PubChem CID | 10050481 |
| Molecular Formula | C23H25IN2O |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (Z)-7-iodo-2-(N-methylanilino)-4-[(E)-2-phenylmethoxyethenyl]hept-2-enenitrile |
| SMILES | CN(/C(C#N)=C\C(/C=C/OCc1ccccc1)CCCI)c1ccccc1 |
| InChI | InChI=1S/C23H25IN2O/c1-26(22-12-6-3-7-13-22)23(18-25)17-20(11-8-15-24)14-16-27-19-21-9-4-2-5-10-21/h2-7,9-10,12-14,16-17,20H,8,11,15,19H2,1H3/b16-14+,23-17- |
| InChIKey | TUGDKNHGGDRHJR-WWZYOZMISA-N |
| XLogP | 6.09 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|