C32H29NO4 — CID 46932770
methyl (E)-4-phenylmethoxy-2-(tritylcarbamoyl)but-3-enoate (PubChem CID 46932770) has the molecular formula C32H29NO4 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl (E)-4-phenylmethoxy-2-(tritylcarbamoyl)but-3-enoate.
| Compound Name | methyl (E)-4-phenylmethoxy-2-(tritylcarbamoyl)but-3-enoate |
|---|---|
| PubChem CID | 46932770 |
| Molecular Formula | C32H29NO4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | methyl (E)-4-phenylmethoxy-2-(tritylcarbamoyl)but-3-enoate |
| SMILES | COC(=O)C(/C=C/OCc1ccccc1)C(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29NO4/c1-36-31(35)29(22-23-37-24-25-14-6-2-7-15-25)30(34)33-32(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-23,29H,24H2,1H3,(H,33,34)/b23-22+ |
| InChIKey | DZADEQNOZFMLIE-GHVJWSGMSA-N |
| XLogP | 5.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|