C14H16N2O — CID 177425455
(2E,4Z)-6-hydroxy-2-(N-methylanilino)hepta-2,4-dienenitrile (PubChem CID 177425455) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (2E,4Z)-6-hydroxy-2-(N-methylanilino)hepta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-6-hydroxy-2-(N-methylanilino)hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 177425455 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2E,4Z)-6-hydroxy-2-(N-methylanilino)hepta-2,4-dienenitrile |
| SMILES | CC(O)/C=C\C=C(/C#N)N(C)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O/c1-12(17)7-6-10-14(11-15)16(2)13-8-4-3-5-9-13/h3-10,12,17H,1-2H3/b7-6-,14-10+ |
| InChIKey | FIWHWRSMBULUGR-KOORZVIOSA-N |
| XLogP | 2.47 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|