C13H13NO — CID 101045564
(E,2E)-2-benzylidene-3-hydroxyhex-4-enenitrile (PubChem CID 101045564) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (E,2E)-2-benzylidene-3-hydroxyhex-4-enenitrile.
| Compound Name | (E,2E)-2-benzylidene-3-hydroxyhex-4-enenitrile |
|---|---|
| PubChem CID | 101045564 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (E,2E)-2-benzylidene-3-hydroxyhex-4-enenitrile |
| SMILES | C/C=C/C(O)/C(C#N)=C/c1ccccc1 |
| InChI | InChI=1S/C13H13NO/c1-2-6-13(15)12(10-14)9-11-7-4-3-5-8-11/h2-9,13,15H,1H3/b6-2+,12-9+ |
| InChIKey | WVIWZCXFNNRHSA-ZFNKDKEHSA-N |
| XLogP | 2.53 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|