C19H20N4O2 — CID 10042637
(2R)-2-benzyl-6-ethynyl-5-oxo-N-propyl-2,3-dihydroimidazo[1,2-c]pyrimidine-8-carboxamide (PubChem CID 10042637) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (2R)-2-benzyl-6-ethynyl-5-oxo-N-propyl-2,3-dihydroimidazo[1,2-c]pyrimidine-8-carboxamide.
| Compound Name | (2R)-2-benzyl-6-ethynyl-5-oxo-N-propyl-2,3-dihydroimidazo[1,2-c]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 10042637 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2R)-2-benzyl-6-ethynyl-5-oxo-N-propyl-2,3-dihydroimidazo[1,2-c]pyrimidine-8-carboxamide |
| SMILES | C#CN1C=C(C(=O)NCCC)C2=N[C@H](Cc3ccccc3)CN2C1=O |
| InChI | InChI=1S/C19H20N4O2/c1-3-10-20-18(24)16-13-22(4-2)19(25)23-12-15(21-17(16)23)11-14-8-6-5-7-9-14/h2,5-9,13,15H,3,10-12H2,1H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | FKBFTKLEWCLXKV-OAHLLOKOSA-N |
| XLogP | 1.75 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|