C21H40O2Si — CID 10043614
1-[(1S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclohex-3-en-1-yl]ethanone (PubChem CID 10043614) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is 1-[(1S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(1S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 10043614 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 1-[(1S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]cyclohex-3-en-1-yl]ethanone |
| SMILES | CCCCCC[C@H](O[Si](C)(C)C(C)(C)C)C1=CC[C@@H](C(C)=O)CC1 |
| InChI | InChI=1S/C21H40O2Si/c1-8-9-10-11-12-20(23-24(6,7)21(3,4)5)19-15-13-18(14-16-19)17(2)22/h15,18,20H,8-14,16H2,1-7H3/t18-,20+/m1/s1 |
| InChIKey | HAGCOTBDNCJWJU-QUCCMNQESA-N |
| XLogP | 6.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|