C25H25N3O — CID 10045507
1-[(1R,12S)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl]-4-(1H-indol-2-yl)butan-1-one (PubChem CID 10045507) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[(1R,12S)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl]-4-(1H-indol-2-yl)butan-1-one.
| Compound Name | 1-[(1R,12S)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl]-4-(1H-indol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 10045507 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[(1R,12S)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-15-yl]-4-(1H-indol-2-yl)butan-1-one |
| SMILES | O=C(CCCc1cc2ccccc2[nH]1)N1[C@H]2CC[C@@H]1c1c([nH]c3ccccc13)C2 |
| InChI | InChI=1S/C25H25N3O/c29-24(11-5-7-17-14-16-6-1-3-9-20(16)26-17)28-18-12-13-23(28)25-19-8-2-4-10-21(19)27-22(25)15-18/h1-4,6,8-10,14,18,23,26-27H,5,7,11-13,15H2/t18-,23+/m0/s1 |
| InChIKey | OTMPWUHPGRZCDR-FDDCHVKYSA-N |
| XLogP | 5.26 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|