C28H44N2 — CID 10047075
3,3,7-trimethyl-N-[4-(3,3,7-trimethyloct-6-enylideneamino)phenyl]oct-6-en-1-imine (PubChem CID 10047075) has the molecular formula C28H44N2 and a molecular weight of 408.67 g/mol. Its IUPAC name is 3,3,7-trimethyl-N-[4-(3,3,7-trimethyloct-6-enylideneamino)phenyl]oct-6-en-1-imine.
| Compound Name | 3,3,7-trimethyl-N-[4-(3,3,7-trimethyloct-6-enylideneamino)phenyl]oct-6-en-1-imine |
|---|---|
| PubChem CID | 10047075 |
| Molecular Formula | C28H44N2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 3,3,7-trimethyl-N-[4-(3,3,7-trimethyloct-6-enylideneamino)phenyl]oct-6-en-1-imine |
| SMILES | CC(C)=CCCC(C)(C)C/C=N/c1ccc(/N=C/CC(C)(C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C28H44N2/c1-23(2)11-9-17-27(5,6)19-21-29-25-13-15-26(16-14-25)30-22-20-28(7,8)18-10-12-24(3)4/h11-16,21-22H,9-10,17-20H2,1-8H3/b29-21+,30-22+ |
| InChIKey | SKBFHQYIVVXWRD-VFIVCBTMSA-N |
| XLogP | 9.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|