C21H30O2S — CID 11727716
(3E)-6,6,10-trimethyl-3-[(S)-(4-methylphenyl)sulfinyl]undeca-3,9-dien-2-one (PubChem CID 11727716) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is (3E)-6,6,10-trimethyl-3-[(S)-(4-methylphenyl)sulfinyl]undeca-3,9-dien-2-one.
| Compound Name | (3E)-6,6,10-trimethyl-3-[(S)-(4-methylphenyl)sulfinyl]undeca-3,9-dien-2-one |
|---|---|
| PubChem CID | 11727716 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3E)-6,6,10-trimethyl-3-[(S)-(4-methylphenyl)sulfinyl]undeca-3,9-dien-2-one |
| SMILES | CC(=O)/C(=C\CC(C)(C)CCC=C(C)C)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H30O2S/c1-16(2)8-7-14-21(5,6)15-13-20(18(4)22)24(23)19-11-9-17(3)10-12-19/h8-13H,7,14-15H2,1-6H3/b20-13+/t24-/m0/s1 |
| InChIKey | AUMSCKFCJBQQDA-RPISRQAYSA-N |
| XLogP | 5.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|