C20H27NOS — CID 11023987
(2E)-5,5,9-trimethyl-2-[(S)-(4-methylphenyl)sulfinyl]deca-2,8-dienenitrile (PubChem CID 11023987) has the molecular formula C20H27NOS and a molecular weight of 329.51 g/mol. Its IUPAC name is (2E)-5,5,9-trimethyl-2-[(S)-(4-methylphenyl)sulfinyl]deca-2,8-dienenitrile.
| Compound Name | (2E)-5,5,9-trimethyl-2-[(S)-(4-methylphenyl)sulfinyl]deca-2,8-dienenitrile |
|---|---|
| PubChem CID | 11023987 |
| Molecular Formula | C20H27NOS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2E)-5,5,9-trimethyl-2-[(S)-(4-methylphenyl)sulfinyl]deca-2,8-dienenitrile |
| SMILES | CC(C)=CCCC(C)(C)C/C=C(\C#N)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27NOS/c1-16(2)7-6-13-20(4,5)14-12-19(15-21)23(22)18-10-8-17(3)9-11-18/h7-12H,6,13-14H2,1-5H3/b19-12+/t23-/m0/s1 |
| InChIKey | SEILTEVUGJARGC-MKXOMJGDSA-N |
| XLogP | 5.67 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|