C26H26O2S — CID 102040409
(E)-4-(4-methylphenyl)sulfinyl-1,7-diphenylhept-4-en-3-one (PubChem CID 102040409) has the molecular formula C26H26O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is (E)-4-(4-methylphenyl)sulfinyl-1,7-diphenylhept-4-en-3-one.
| Compound Name | (E)-4-(4-methylphenyl)sulfinyl-1,7-diphenylhept-4-en-3-one |
|---|---|
| PubChem CID | 102040409 |
| Molecular Formula | C26H26O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (E)-4-(4-methylphenyl)sulfinyl-1,7-diphenylhept-4-en-3-one |
| SMILES | Cc1ccc(S(=O)/C(=C/CCc2ccccc2)C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O2S/c1-21-15-18-24(19-16-21)29(28)26(14-8-13-22-9-4-2-5-10-22)25(27)20-17-23-11-6-3-7-12-23/h2-7,9-12,14-16,18-19H,8,13,17,20H2,1H3/b26-14+ |
| InChIKey | HJYFXNVWIKTKAR-VULFUBBASA-N |
| XLogP | 5.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|