C29H27FN2O3S — CID 100501509
N-[2-(4-fluorophenyl)ethyl]-4-[(N-methylsulfonyl-2-phenylanilino)methyl]benzamide (PubChem CID 100501509) has the molecular formula C29H27FN2O3S and a molecular weight of 502.61 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-[(N-methylsulfonyl-2-phenylanilino)methyl]benzamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-[(N-methylsulfonyl-2-phenylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 100501509 |
| Molecular Formula | C29H27FN2O3S |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-[(N-methylsulfonyl-2-phenylanilino)methyl]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NCCc2ccc(F)cc2)cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C29H27FN2O3S/c1-36(34,35)32(28-10-6-5-9-27(28)24-7-3-2-4-8-24)21-23-11-15-25(16-12-23)29(33)31-20-19-22-13-17-26(30)18-14-22/h2-18H,19-21H2,1H3,(H,31,33) |
| InChIKey | JBGYUHJWHKNNCQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |