C21H24ClF3N2O5S — CID 100504848
4-[4-chloro-N-methylsulfonyl-2-(trifluoromethyl)anilino]-N-[2-(2-methoxyphenoxy)ethyl]butanamide (PubChem CID 100504848) has the molecular formula C21H24ClF3N2O5S and a molecular weight of 508.95 g/mol. Its IUPAC name is 4-[4-chloro-N-methylsulfonyl-2-(trifluoromethyl)anilino]-N-[2-(2-methoxyphenoxy)ethyl]butanamide.
| Compound Name | 4-[4-chloro-N-methylsulfonyl-2-(trifluoromethyl)anilino]-N-[2-(2-methoxyphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 100504848 |
| Molecular Formula | C21H24ClF3N2O5S |
| Molecular Weight | 508.95 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 4-[4-chloro-N-methylsulfonyl-2-(trifluoromethyl)anilino]-N-[2-(2-methoxyphenoxy)ethyl]butanamide |
| SMILES | COc1ccccc1OCCNC(=O)CCCN(c1ccc(Cl)cc1C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C21H24ClF3N2O5S/c1-31-18-6-3-4-7-19(18)32-13-11-26-20(28)8-5-12-27(33(2,29)30)17-10-9-15(22)14-16(17)21(23,24)25/h3-4,6-7,9-10,14H,5,8,11-13H2,1-2H3,(H,26,28) |
| InChIKey | QAJVLEBBPSPMMJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.95 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|