C20H24Cl2N2O5S — CID 100500855
4-(2,3-dichloro-N-methylsulfonylanilino)-N-[2-(3-methoxyphenoxy)ethyl]butanamide (PubChem CID 100500855) has the molecular formula C20H24Cl2N2O5S and a molecular weight of 475.39 g/mol. Its IUPAC name is 4-(2,3-dichloro-N-methylsulfonylanilino)-N-[2-(3-methoxyphenoxy)ethyl]butanamide.
| Compound Name | 4-(2,3-dichloro-N-methylsulfonylanilino)-N-[2-(3-methoxyphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 100500855 |
| Molecular Formula | C20H24Cl2N2O5S |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 4-(2,3-dichloro-N-methylsulfonylanilino)-N-[2-(3-methoxyphenoxy)ethyl]butanamide |
| SMILES | COc1cccc(OCCNC(=O)CCCN(c2cccc(Cl)c2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H24Cl2N2O5S/c1-28-15-6-3-7-16(14-15)29-13-11-23-19(25)10-5-12-24(30(2,26)27)18-9-4-8-17(21)20(18)22/h3-4,6-9,14H,5,10-13H2,1-2H3,(H,23,25) |
| InChIKey | KFWAQTSRSPOIRD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|