C24H27F3N2O5 — CID 10050822
(N,N'-dicyclohexylcarbamimidoyl) 2-oxo-6-(trifluoromethoxy)chromene-3-carboxylate (PubChem CID 10050822) has the molecular formula C24H27F3N2O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) 2-oxo-6-(trifluoromethoxy)chromene-3-carboxylate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) 2-oxo-6-(trifluoromethoxy)chromene-3-carboxylate |
|---|---|
| PubChem CID | 10050822 |
| Molecular Formula | C24H27F3N2O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) 2-oxo-6-(trifluoromethoxy)chromene-3-carboxylate |
| SMILES | O=C(O/C(=N/C1CCCCC1)NC1CCCCC1)c1cc2cc(OC(F)(F)F)ccc2oc1=O |
| InChI | InChI=1S/C24H27F3N2O5/c25-24(26,27)34-18-11-12-20-15(13-18)14-19(21(30)32-20)22(31)33-23(28-16-7-3-1-4-8-16)29-17-9-5-2-6-10-17/h11-14,16-17H,1-10H2,(H,28,29) |
| InChIKey | AXAMLLVDDMJFEH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|