C25H32N2O6 — CID 10456763
(N,N'-dicyclohexylcarbamimidoyl) 5,7-dimethoxy-2-oxochromene-3-carboxylate (PubChem CID 10456763) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) 5,7-dimethoxy-2-oxochromene-3-carboxylate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) 5,7-dimethoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 10456763 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) 5,7-dimethoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1cc(OC)c2cc(C(=O)O/C(=N\C3CCCCC3)NC3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H32N2O6/c1-30-18-13-21(31-2)19-15-20(23(28)32-22(19)14-18)24(29)33-25(26-16-9-5-3-6-10-16)27-17-11-7-4-8-12-17/h13-17H,3-12H2,1-2H3,(H,26,27) |
| InChIKey | WFAPIRZXHVGJEF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|