C24H30N2O5 — CID 10410205
(N,N'-dicyclohexylcarbamimidoyl) 7-methoxy-2-oxochromene-3-carboxylate (PubChem CID 10410205) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (N,N'-dicyclohexylcarbamimidoyl) 7-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | (N,N'-dicyclohexylcarbamimidoyl) 7-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 10410205 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (N,N'-dicyclohexylcarbamimidoyl) 7-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1ccc2cc(C(=O)O/C(=N/C3CCCCC3)NC3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H30N2O5/c1-29-19-13-12-16-14-20(22(27)30-21(16)15-19)23(28)31-24(25-17-8-4-2-5-9-17)26-18-10-6-3-7-11-18/h12-15,17-18H,2-11H2,1H3,(H,25,26) |
| InChIKey | KOZAWEVFHXHOBU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|