C17H20N2O4 — CID 100953042
[N,N'-di(propan-2-yl)carbamimidoyl] 2-oxochromene-3-carboxylate (PubChem CID 100953042) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is [N,N'-di(propan-2-yl)carbamimidoyl] 2-oxochromene-3-carboxylate.
| Compound Name | [N,N'-di(propan-2-yl)carbamimidoyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 100953042 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [N,N'-di(propan-2-yl)carbamimidoyl] 2-oxochromene-3-carboxylate |
| SMILES | CC(C)/N=C(\NC(C)C)OC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H20N2O4/c1-10(2)18-17(19-11(3)4)23-16(21)13-9-12-7-5-6-8-14(12)22-15(13)20/h5-11H,1-4H3,(H,18,19) |
| InChIKey | OAZHVPSDGVWIEO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|