C26H40O7Si — CID 10051355
(2S,4R,4aS,10bR)-8-ethenyl-2,9-dimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione (PubChem CID 10051355) has the molecular formula C26H40O7Si and a molecular weight of 492.69 g/mol. Its IUPAC name is (2S,4R,4aS,10bR)-8-ethenyl-2,9-dimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione.
| Compound Name | (2S,4R,4aS,10bR)-8-ethenyl-2,9-dimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione |
|---|---|
| PubChem CID | 10051355 |
| Molecular Formula | C26H40O7Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (2S,4R,4aS,10bR)-8-ethenyl-2,9-dimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione |
| SMILES | C=CC1=C(OC)C(=O)C2=C(CO[C@H]3[C@@H]2C[C@@H](OC)O[C@@H]3CO[Si](C(C)C)(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C26H40O7Si/c1-10-17-23(27)19-12-31-25-18(22(19)24(28)26(17)30-9)11-21(29-8)33-20(25)13-32-34(14(2)3,15(4)5)16(6)7/h10,14-16,18,20-21,25H,1,11-13H2,2-9H3/t18-,20-,21+,25+/m1/s1 |
| InChIKey | NMDIPBCCIASUNO-ZHBILRMLSA-N |
| XLogP | 4.49 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|