C25H40O8Si — CID 10255294
(2S,4R,4aS,10bR)-2,8,9-trimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione (PubChem CID 10255294) has the molecular formula C25H40O8Si and a molecular weight of 496.67 g/mol. Its IUPAC name is (2S,4R,4aS,10bR)-2,8,9-trimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione.
| Compound Name | (2S,4R,4aS,10bR)-2,8,9-trimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione |
|---|---|
| PubChem CID | 10255294 |
| Molecular Formula | C25H40O8Si |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (2S,4R,4aS,10bR)-2,8,9-trimethoxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione |
| SMILES | COC1=C(OC)C(=O)C2=C(CO[C@H]3[C@@H]2C[C@@H](OC)O[C@@H]3CO[Si](C(C)C)(C(C)C)C(C)C)C1=O |
| InChI | InChI=1S/C25H40O8Si/c1-13(2)34(14(3)4,15(5)6)32-12-18-23-16(10-19(28-7)33-18)20-17(11-31-23)21(26)24(29-8)25(30-9)22(20)27/h13-16,18-19,23H,10-12H2,1-9H3/t16-,18-,19+,23+/m1/s1 |
| InChIKey | ZUWIDGJOXFKSQY-NZQNYPKQSA-N |
| XLogP | 3.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|