C30H50O7Si — CID 11757327
(1R,2S,4R,4aS,10bR)-8-butyl-1-deuterio-2-methoxy-9-propan-2-yloxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione (PubChem CID 11757327) has the molecular formula C30H50O7Si and a molecular weight of 551.82 g/mol. Its IUPAC name is (1R,2S,4R,4aS,10bR)-8-butyl-1-deuterio-2-methoxy-9-propan-2-yloxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione.
| Compound Name | (1R,2S,4R,4aS,10bR)-8-butyl-1-deuterio-2-methoxy-9-propan-2-yloxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione |
|---|---|
| PubChem CID | 11757327 |
| Molecular Formula | C30H50O7Si |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | (1R,2S,4R,4aS,10bR)-8-butyl-1-deuterio-2-methoxy-9-propan-2-yloxy-4-[tri(propan-2-yl)silyloxymethyl]-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene-7,10-dione |
| SMILES | [2H][C@H]1[C@@H](OC)O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]2OCC3=C(C(=O)C(OC(C)C)=C(CCCC)C3=O)[C@@H]12 |
| InChI | InChI=1S/C30H50O7Si/c1-11-12-13-21-27(31)23-15-34-29-22(26(23)28(32)30(21)36-17(2)3)14-25(33-10)37-24(29)16-35-38(18(4)5,19(6)7)20(8)9/h17-20,22,24-25,29H,11-16H2,1-10H3/t22-,24-,25+,29+/m1/s1/i14D/t14-,22-,24-,25+,29+ |
| InChIKey | XRTRLABBSNDADI-BKVBVSRKSA-N |
| XLogP | 6.27 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|