C20H36O8Si — CID 122399884
dimethyl (2R,3R,4R)-3-(methoxymethoxy)-3-methyl-2-pentyl-4-trimethylsilyloxy-2,4-dihydropyran-5,6-dicarboxylate (PubChem CID 122399884) has the molecular formula C20H36O8Si and a molecular weight of 432.59 g/mol. Its IUPAC name is dimethyl (2R,3R,4R)-3-(methoxymethoxy)-3-methyl-2-pentyl-4-trimethylsilyloxy-2,4-dihydropyran-5,6-dicarboxylate.
| Compound Name | dimethyl (2R,3R,4R)-3-(methoxymethoxy)-3-methyl-2-pentyl-4-trimethylsilyloxy-2,4-dihydropyran-5,6-dicarboxylate |
|---|---|
| PubChem CID | 122399884 |
| Molecular Formula | C20H36O8Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | dimethyl (2R,3R,4R)-3-(methoxymethoxy)-3-methyl-2-pentyl-4-trimethylsilyloxy-2,4-dihydropyran-5,6-dicarboxylate |
| SMILES | CCCCC[C@H]1OC(C(=O)OC)=C(C(=O)OC)[C@@H](O[Si](C)(C)C)[C@]1(C)OCOC |
| InChI | InChI=1S/C20H36O8Si/c1-9-10-11-12-14-20(2,26-13-23-3)17(28-29(6,7)8)15(18(21)24-4)16(27-14)19(22)25-5/h14,17H,9-13H2,1-8H3/t14-,17-,20-/m1/s1 |
| InChIKey | ISMXEHUSMJYMGY-WIBUTAKZSA-N |
| XLogP | 3.16 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|