C30H54NO+ — CID 10053782
(2S,4S)-1,1,3,3-tetramethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol (PubChem CID 10053782) has the molecular formula C30H54NO+ and a molecular weight of 444.77 g/mol. Its IUPAC name is (2S,4S)-1,1,3,3-tetramethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol.
| Compound Name | (2S,4S)-1,1,3,3-tetramethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 10053782 |
| Molecular Formula | C30H54NO+ |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 444.42 |
| IUPAC Name | (2S,4S)-1,1,3,3-tetramethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-1-ium-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC[C@H]1C(C)(C)[C@@H](O)CC[N+]1(C)C |
| InChI | InChI=1S/C30H54NO/c1-24(2)14-12-17-26(4)19-13-18-25(3)15-10-11-16-27(5)20-21-28-30(6,7)29(32)22-23-31(28,8)9/h14-16,19,28-29,32H,10-13,17-18,20-23H2,1-9H3/q+1/b25-15+,26-19+,27-16+/t28-,29-/m0/s1 |
| InChIKey | QVHKKQSZCSBHRJ-XAWSBZSWSA-N |
| XLogP | 8.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|