C58H62O13 — CID 10056754
1-O-benzyl 4-O-[(2R,3S,4S)-3,4-dihydroxy-5-oxo-2-phenylmethoxy-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexyl] butanedioate (PubChem CID 10056754) has the molecular formula C58H62O13 and a molecular weight of 967.12 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[(2R,3S,4S)-3,4-dihydroxy-5-oxo-2-phenylmethoxy-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexyl] butanedioate.
| Compound Name | 1-O-benzyl 4-O-[(2R,3S,4S)-3,4-dihydroxy-5-oxo-2-phenylmethoxy-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexyl] butanedioate |
|---|---|
| PubChem CID | 10056754 |
| Molecular Formula | C58H62O13 |
| Molecular Weight | 967.12 g/mol |
| Exact Mass | 966.42 |
| IUPAC Name | 1-O-benzyl 4-O-[(2R,3S,4S)-3,4-dihydroxy-5-oxo-2-phenylmethoxy-6-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hexyl] butanedioate |
| SMILES | O=C(CCC(=O)OC[C@@H](OCc1ccccc1)[C@@H](O)[C@H](O)C(=O)C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C58H62O13/c59-48(54(62)55(63)50(65-35-43-21-9-2-10-22-43)41-67-53(61)32-31-52(60)66-36-44-23-11-3-12-24-44)33-49-56(68-37-45-25-13-4-14-26-45)58(70-39-47-29-17-6-18-30-47)57(69-38-46-27-15-5-16-28-46)51(71-49)40-64-34-42-19-7-1-8-20-42/h1-30,49-51,54-58,62-63H,31-41H2/t49-,50-,51-,54-,55-,56+,57-,58-/m1/s1 |
| InChIKey | ITEJXOHKSZWIQG-WHIHUKBHSA-N |
| XLogP | 8.06 |
| TPSA | 165.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.12 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |